C28H32N6O4 — CID 166454321
9-[4-(oxetan-3-yl)piperazine-1-carbonyl]-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6(11),7,9,20(24),21-heptaene-2,19-dione (PubChem CID 166454321) has the molecular formula C28H32N6O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 9-[4-(oxetan-3-yl)piperazine-1-carbonyl]-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6(11),7,9,20(24),21-heptaene-2,19-dione.
| Compound Name | 9-[4-(oxetan-3-yl)piperazine-1-carbonyl]-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6(11),7,9,20(24),21-heptaene-2,19-dione |
|---|---|
| PubChem CID | 166454321 |
| Molecular Formula | C28H32N6O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 9-[4-(oxetan-3-yl)piperazine-1-carbonyl]-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6(11),7,9,20(24),21-heptaene-2,19-dione |
| SMILES | O=C1NCCCCCn2c(nc3ccc(C(=O)N4CCN(C5COC5)CC4)cc32)NC(=O)c2cccc1c2 |
| InChI | InChI=1S/C28H32N6O4/c35-25-19-5-4-6-20(15-19)26(36)31-28-30-23-8-7-21(16-24(23)34(28)10-3-1-2-9-29-25)27(37)33-13-11-32(12-14-33)22-17-38-18-22/h4-8,15-16,22H,1-3,9-14,17-18H2,(H,29,35)(H,30,31,36) |
| InChIKey | MCUJDABNNPGFSU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |