C26H30N6O3 — CID 166454191
13-methyl-10-(piperazine-1-carbonyl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione (PubChem CID 166454191) has the molecular formula C26H30N6O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is 13-methyl-10-(piperazine-1-carbonyl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione.
| Compound Name | 13-methyl-10-(piperazine-1-carbonyl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione |
|---|---|
| PubChem CID | 166454191 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 13-methyl-10-(piperazine-1-carbonyl)-3,5,12,18-tetrazatetracyclo[18.3.1.04,12.06,11]tetracosa-1(23),4,6,8,10,20(24),21-heptaene-2,19-dione |
| SMILES | CC1CCCCNC(=O)c2cccc(c2)C(=O)Nc2nc3cccc(C(=O)N4CCNCC4)c3n21 |
| InChI | InChI=1S/C26H30N6O3/c1-17-6-2-3-11-28-23(33)18-7-4-8-19(16-18)24(34)30-26-29-21-10-5-9-20(22(21)32(17)26)25(35)31-14-12-27-13-15-31/h4-5,7-10,16-17,27H,2-3,6,11-15H2,1H3,(H,28,33)(H,29,30,34) |
| InChIKey | CWQBNGSOXRRFPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |