C14H18F3NO2 — CID 166460992
4-[2-[ethyl(3,3,3-trifluoropropyl)amino]ethyl]benzoic acid (PubChem CID 166460992) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-[2-[ethyl(3,3,3-trifluoropropyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[ethyl(3,3,3-trifluoropropyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 166460992 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[2-[ethyl(3,3,3-trifluoropropyl)amino]ethyl]benzoic acid |
| SMILES | CCN(CCc1ccc(C(=O)O)cc1)CCC(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-2-18(10-8-14(15,16)17)9-7-11-3-5-12(6-4-11)13(19)20/h3-6H,2,7-10H2,1H3,(H,19,20) |
| InChIKey | LDEAFRDLRDPHIW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |