C18H26N2O2S — CID 166467671
3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbaldehyde;3-methylthietane (PubChem CID 166467671) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbaldehyde;3-methylthietane.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbaldehyde;3-methylthietane |
|---|---|
| PubChem CID | 166467671 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5-methoxyindole-1-carbaldehyde;3-methylthietane |
| SMILES | CC1CSC1.COc1ccc2c(c1)c(CCN(C)C)cn2C=O |
| InChI | InChI=1S/C14H18N2O2.C4H8S/c1-15(2)7-6-11-9-16(10-17)14-5-4-12(18-3)8-13(11)14;1-4-2-5-3-4/h4-5,8-10H,6-7H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | GKOGFGHYBAGTNQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|