C28H32FN3O4 — CID 166469192
1-cyclopentyl-3-phenylpyrrolidine;[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite (PubChem CID 166469192) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-phenylpyrrolidine;[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite.
| Compound Name | 1-cyclopentyl-3-phenylpyrrolidine;[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 166469192 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-cyclopentyl-3-phenylpyrrolidine;[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite |
| SMILES | O=C1CCC(N2Cc3cc(OF)ccc3C2=O)C(=O)N1.c1ccc(C2CCN(C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C15H21N.C13H11FN2O4/c1-2-6-13(7-3-1)14-10-11-16(12-14)15-8-4-5-9-15;14-20-8-1-2-9-7(5-8)6-16(13(9)19)10-3-4-11(17)15-12(10)18/h1-3,6-7,14-15H,4-5,8-12H2;1-2,5,10H,3-4,6H2,(H,15,17,18) |
| InChIKey | ZYJNQYIDGDRXTL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|