C10H19F3N2 — CID 166470688
(Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine;molecular hydrogen (PubChem CID 166470688) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine;molecular hydrogen.
| Compound Name | (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 166470688 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine;molecular hydrogen |
| SMILES | C/C=C\C(CC(NC)C(F)(F)F)=N/CC.[H][H] |
| InChI | InChI=1S/C10H17F3N2.H2/c1-4-6-8(15-5-2)7-9(14-3)10(11,12)13;/h4,6,9,14H,5,7H2,1-3H3;1H/b6-4-,15-8+; |
| InChIKey | SYEXIQUKDVIWIY-XYOKHZBNSA-N |
| XLogP | 2.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|