C10H17F3N2 — CID 166470689
(Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine (PubChem CID 166470689) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine.
| Compound Name | (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine |
|---|---|
| PubChem CID | 166470689 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (Z)-4-ethylimino-1,1,1-trifluoro-N-methylhept-5-en-2-amine |
| SMILES | C/C=C\C(CC(NC)C(F)(F)F)=N/CC |
| InChI | InChI=1S/C10H17F3N2/c1-4-6-8(15-5-2)7-9(14-3)10(11,12)13/h4,6,9,14H,5,7H2,1-3H3/b6-4-,15-8+ |
| InChIKey | HLYVGPISBRTVFX-KKMCOEOTSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|