C24H30F3N7O — CID 166476226
1-[8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-methyl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]pent-4-en-1-one;ethane (PubChem CID 166476226) has the molecular formula C24H30F3N7O and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-methyl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]pent-4-en-1-one;ethane.
| Compound Name | 1-[8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-methyl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]pent-4-en-1-one;ethane |
|---|---|
| PubChem CID | 166476226 |
| Molecular Formula | C24H30F3N7O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-[8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-methyl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]pent-4-en-1-one;ethane |
| SMILES | C=CCCC(=O)N1CCc2c(c(NCc3cc(N)cc(C(F)(F)F)c3)nc3nnc(C)n23)C1.CC |
| InChI | InChI=1S/C22H24F3N7O.C2H6/c1-3-4-5-19(33)31-7-6-18-17(12-31)20(28-21-30-29-13(2)32(18)21)27-11-14-8-15(22(23,24)25)10-16(26)9-14;1-2/h3,8-10H,1,4-7,11-12,26H2,2H3,(H,27,28,30);1-2H3 |
| InChIKey | QSPANZIEKWGPMT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|