C24H29F3N8O2 — CID 166476332
[8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-propan-2-yl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]-morpholin-4-ylmethanone (PubChem CID 166476332) has the molecular formula C24H29F3N8O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is [8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-propan-2-yl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]-morpholin-4-ylmethanone.
| Compound Name | [8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-propan-2-yl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 166476332 |
| Molecular Formula | C24H29F3N8O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [8-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-3-propan-2-yl-2,4,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)c1nnc2nc(NCc3cc(N)cc(C(F)(F)F)c3)c3c(n12)CCN(C(=O)N1CCOCC1)C3 |
| InChI | InChI=1S/C24H29F3N8O2/c1-14(2)21-31-32-22-30-20(29-12-15-9-16(24(25,26)27)11-17(28)10-15)18-13-34(4-3-19(18)35(21)22)23(36)33-5-7-37-8-6-33/h9-11,14H,3-8,12-13,28H2,1-2H3,(H,29,30,32) |
| InChIKey | FCEVNQNKVPGVAZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|