C23H26F3N7O2 — CID 166476327
[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(oxan-4-yl)methanone (PubChem CID 166476327) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(oxan-4-yl)methanone.
| Compound Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 166476327 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(oxan-4-yl)methanone |
| SMILES | Cc1nnc2nc(NC(C)c3cc(N)cc(C(F)(F)F)c3)c3c(n12)CN(C(=O)C1CCOCC1)C3 |
| InChI | InChI=1S/C23H26F3N7O2/c1-12(15-7-16(23(24,25)26)9-17(27)8-15)28-20-18-10-32(21(34)14-3-5-35-6-4-14)11-19(18)33-13(2)30-31-22(33)29-20/h7-9,12,14H,3-6,10-11,27H2,1-2H3,(H,28,29,31) |
| InChIKey | SRTICPBQGTZTPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|