C20H20F3N7O — CID 166476170
1-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-2-methylprop-2-en-1-one (PubChem CID 166476170) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 166476170 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1Cc2c(NC(C)c3cc(N)cc(C(F)(F)F)c3)nc3nncn3c2C1 |
| InChI | InChI=1S/C20H20F3N7O/c1-10(2)18(31)29-7-15-16(8-29)30-9-25-28-19(30)27-17(15)26-11(3)12-4-13(20(21,22)23)6-14(24)5-12/h4-6,9,11H,1,7-8,24H2,2-3H3,(H,26,27,28) |
| InChIKey | BEYSUWPHLMRFNF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|