C22H24F3N7O2 — CID 166476723
[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone (PubChem CID 166476723) has the molecular formula C22H24F3N7O2 and a molecular weight of 475.48 g/mol. Its IUPAC name is [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone.
| Compound Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone |
|---|---|
| PubChem CID | 166476723 |
| Molecular Formula | C22H24F3N7O2 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone |
| SMILES | Cc1nnc2nc(NC(C)c3cc(N)cc(C(F)(F)F)c3)c3c(n12)CN(C(=O)C1(C)COC1)C3 |
| InChI | InChI=1S/C22H24F3N7O2/c1-11(13-4-14(22(23,24)25)6-15(26)5-13)27-18-16-7-31(19(33)21(3)9-34-10-21)8-17(16)32-12(2)29-30-20(32)28-18/h4-6,11H,7-10,26H2,1-3H3,(H,27,28,30) |
| InChIKey | YMAMDEAXKBCGOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|