C25H28F3N7O — CID 166594758
[7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-bicyclo[1.1.1]pentanyl)methanone (PubChem CID 166594758) has the molecular formula C25H28F3N7O and a molecular weight of 499.54 g/mol. Its IUPAC name is [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-bicyclo[1.1.1]pentanyl)methanone.
| Compound Name | [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-bicyclo[1.1.1]pentanyl)methanone |
|---|---|
| PubChem CID | 166594758 |
| Molecular Formula | C25H28F3N7O |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-bicyclo[1.1.1]pentanyl)methanone |
| SMILES | CC(C)c1nnc2nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)c3c(n12)CN(C(=O)C12CC(C1)C2)C3 |
| InChI | InChI=1S/C25H28F3N7O/c1-12(2)21-32-33-23-31-20(30-13(3)15-4-16(25(26,27)28)6-17(29)5-15)18-10-34(11-19(18)35(21)23)22(36)24-7-14(8-24)9-24/h4-6,12-14H,7-11,29H2,1-3H3,(H,30,31,33)/t13-,14?,24?/m1/s1 |
| InChIKey | MOQXRWMVXCOACZ-IJNCDGCFSA-N |
| XLogP | 4.66 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|