C20H30F4O6 — CID 166479482
1-(3-ethyl-2,4,5,6-tetrafluorophenoxy)-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propan-1-ol (PubChem CID 166479482) has the molecular formula C20H30F4O6 and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-(3-ethyl-2,4,5,6-tetrafluorophenoxy)-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propan-1-ol.
| Compound Name | 1-(3-ethyl-2,4,5,6-tetrafluorophenoxy)-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propan-1-ol |
|---|---|
| PubChem CID | 166479482 |
| Molecular Formula | C20H30F4O6 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-(3-ethyl-2,4,5,6-tetrafluorophenoxy)-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propan-1-ol |
| SMILES | CCCOCCOCCOCCOCCC(O)Oc1c(F)c(F)c(F)c(CC)c1F |
| InChI | InChI=1S/C20H30F4O6/c1-3-6-26-8-10-28-12-13-29-11-9-27-7-5-15(25)30-20-17(22)14(4-2)16(21)18(23)19(20)24/h15,25H,3-13H2,1-2H3 |
| InChIKey | ABMXNPSQGYVYHH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|