C16H22F4O — CID 170603031
1,2,4,5-tetrafluoro-3-(4-methylpentyl)-6-(propoxymethyl)benzene (PubChem CID 170603031) has the molecular formula C16H22F4O and a molecular weight of 306.34 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(4-methylpentyl)-6-(propoxymethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(4-methylpentyl)-6-(propoxymethyl)benzene |
|---|---|
| PubChem CID | 170603031 |
| Molecular Formula | C16H22F4O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(4-methylpentyl)-6-(propoxymethyl)benzene |
| SMILES | CCCOCc1c(F)c(F)c(CCCC(C)C)c(F)c1F |
| InChI | InChI=1S/C16H22F4O/c1-4-8-21-9-12-15(19)13(17)11(14(18)16(12)20)7-5-6-10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | ZQFANGMKCYUBTA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|