C27H33F5N2O7 — CID 166480079
(2,3,4,5,6-pentafluorophenyl) 3-[1-[1-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl]oxypropanoate (PubChem CID 166480079) has the molecular formula C27H33F5N2O7 and a molecular weight of 592.56 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[1-[1-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl]oxypropanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[1-[1-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 166480079 |
| Molecular Formula | C27H33F5N2O7 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[1-[1-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl]oxypropanoate |
| SMILES | CC(C)(CNC(=O)CCCCCN1C(=O)C=CC1=O)OCC(C)(C)OCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H33F5N2O7/c1-26(2,14-33-16(35)8-6-5-7-12-34-17(36)9-10-18(34)37)40-15-27(3,4)39-13-11-19(38)41-25-23(31)21(29)20(28)22(30)24(25)32/h9-10H,5-8,11-15H2,1-4H3,(H,33,35) |
| InChIKey | BOGXLVRVLUGDRR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|