C11H13F3N2O3 — CID 166492541
ethyl 3-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-3-oxopropanoate (PubChem CID 166492541) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is ethyl 3-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 166492541 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 3-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cn(CC(F)(F)F)nc1C |
| InChI | InChI=1S/C11H13F3N2O3/c1-3-19-10(18)4-9(17)8-5-16(15-7(8)2)6-11(12,13)14/h5H,3-4,6H2,1-2H3 |
| InChIKey | UHDXVQARUDVMFT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|