C40H45N4O+ — CID 166496328
2,4-ditert-butyl-6-[4-[2-(3,7-dimethyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium-4-yl]-3,5-dimethylphenyl]-1,3,5-triazine (PubChem CID 166496328) has the molecular formula C40H45N4O+ and a molecular weight of 597.83 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[2-(3,7-dimethyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium-4-yl]-3,5-dimethylphenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[4-[2-(3,7-dimethyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium-4-yl]-3,5-dimethylphenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166496328 |
| Molecular Formula | C40H45N4O+ |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[2-(3,7-dimethyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium-4-yl]-3,5-dimethylphenyl]-1,3,5-triazine |
| SMILES | Cc1ccc2c(c1)oc1c(-c3cc(-c4c(C)cc(-c5nc(C(C)(C)C)nc(C(C)(C)C)n5)cc4C)c(C)c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C40H45N4O/c1-22-13-15-28-29-16-14-23(2)34(35(29)45-32(28)17-22)31-20-30(26(5)21-44(31)12)33-24(3)18-27(19-25(33)4)36-41-37(39(6,7)8)43-38(42-36)40(9,10)11/h13-21H,1-12H3/q+1 |
| InChIKey | CPIABWUFJXDXRU-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 55.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|