C17H30O8 — CID 166508437
tert-butyl (E)-6-[(2R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate (PubChem CID 166508437) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is tert-butyl (E)-6-[(2R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate.
| Compound Name | tert-butyl (E)-6-[(2R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 166508437 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | tert-butyl (E)-6-[(2R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate |
| SMILES | CC(CC/C=C/C(=O)OC(C)(C)C)O[C@@H]1OC(CO)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C17H30O8/c1-10(7-5-6-8-12(19)25-17(2,3)4)23-16-15(22)14(21)13(20)11(9-18)24-16/h6,8,10-11,13-16,18,20-22H,5,7,9H2,1-4H3/b8-6+/t10?,11?,13-,14-,15?,16-/m1/s1 |
| InChIKey | AVJHFROWMKFXNH-GVHXKXEVSA-N |
| XLogP | -0.13 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|