C18H32O8 — CID 166508439
tert-butyl (E)-6-methyl-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate (PubChem CID 166508439) has the molecular formula C18H32O8 and a molecular weight of 376.45 g/mol. Its IUPAC name is tert-butyl (E)-6-methyl-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate.
| Compound Name | tert-butyl (E)-6-methyl-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 166508439 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | tert-butyl (E)-6-methyl-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/CCC(C)(C)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32O8/c1-17(2,3)25-12(20)8-6-7-9-18(4,5)26-16-15(23)14(22)13(21)11(10-19)24-16/h6,8,11,13-16,19,21-23H,7,9-10H2,1-5H3/b8-6+/t11-,13-,14+,15-,16?/m1/s1 |
| InChIKey | WHOCSPMVGCWLJU-BYNGHNEWSA-N |
| XLogP | 0.26 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|