C24H16N4S — CID 166512417
9-methyl-6,7-diphenyl-4-prop-1-ynyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 166512417) has the molecular formula C24H16N4S and a molecular weight of 392.49 g/mol. Its IUPAC name is 9-methyl-6,7-diphenyl-4-prop-1-ynyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 9-methyl-6,7-diphenyl-4-prop-1-ynyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 166512417 |
| Molecular Formula | C24H16N4S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 9-methyl-6,7-diphenyl-4-prop-1-ynyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CC#Cc1c2nsnc2c(C)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H16N4S/c1-3-10-18-23-19(15(2)20-24(18)28-29-27-20)25-21(16-11-6-4-7-12-16)22(26-23)17-13-8-5-9-14-17/h4-9,11-14H,1-2H3 |
| InChIKey | GSXTWBYQMLRJEU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|