C12H18O3 — CID 166518631
2-(1-hydroxypropylidene)-5-propylcyclohexane-1,3-dione (PubChem CID 166518631) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-(1-hydroxypropylidene)-5-propylcyclohexane-1,3-dione.
| Compound Name | 2-(1-hydroxypropylidene)-5-propylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 166518631 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-(1-hydroxypropylidene)-5-propylcyclohexane-1,3-dione |
| SMILES | CCCC1CC(=O)C(=C(O)CC)C(=O)C1 |
| InChI | InChI=1S/C12H18O3/c1-3-5-8-6-10(14)12(9(13)4-2)11(15)7-8/h8,13H,3-7H2,1-2H3/b12-9- |
| InChIKey | OXJCQJDSDPKLBZ-XFXZXTDPSA-N |
| XLogP | 2.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|