C7H9NO3 — CID 141327495
3-(1-hydroxypropylidene)pyrrolidine-2,4-dione (PubChem CID 141327495) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 3-(1-hydroxypropylidene)pyrrolidine-2,4-dione.
| Compound Name | 3-(1-hydroxypropylidene)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 141327495 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 3-(1-hydroxypropylidene)pyrrolidine-2,4-dione |
| SMILES | CCC(O)=C1C(=O)CNC1=O |
| InChI | InChI=1S/C7H9NO3/c1-2-4(9)6-5(10)3-8-7(6)11/h9H,2-3H2,1H3,(H,8,11) |
| InChIKey | FUXBMTFWYPXUMR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|