About 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline
4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 166524115) has the molecular formula C20H18N6
and a molecular weight of 342.41 g/mol. Its IUPAC name is 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline.
Molecular Properties
| Compound Name | 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline |
| PubChem CID | 166524115 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(N)cc3)n2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C20H18N6/c21-15-5-1-13(2-6-15)19-24-25-20(14-3-7-16(22)8-4-14)26(19)18-11-9-17(23)10-12-18/h1-12H,21-23H2 |
| InChIKey | CTDMVJVZZXNKPC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline?
The IUPAC name of 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline (CID 166524115) is 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline.
What is the SMILES notation for 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline?
The canonical SMILES for 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline is Nc1ccc(-c2nnc(-c3ccc(N)cc3)n2-c2ccc(N)cc2)cc1.
What is the InChIKey of 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline?
The InChIKey is CTDMVJVZZXNKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6/c21-15-5-1-13(2-6-15)19-24-25-20(14-3-7-16(22)8-4-14)26(19)18-11-9-17(23)10-12-18/h1-12H,21-23H2.
What are the key properties of 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline?
4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline has a molecular weight of 342.41 g/mol, XLogP of 3.35, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-bis(4-aminophenyl)-1,2,4-triazol-3-yl]aniline is sourced from PubChem (CID 166524115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).