C11H25NO4Si — CID 166524490
(2R,3R,4R,5S)-2-(hydroxymethyl)-2-(2-trimethylsilylethyl)piperidine-3,4,5-triol (PubChem CID 166524490) has the molecular formula C11H25NO4Si and a molecular weight of 263.41 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-2-(2-trimethylsilylethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-2-(2-trimethylsilylethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166524490 |
| Molecular Formula | C11H25NO4Si |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-2-(2-trimethylsilylethyl)piperidine-3,4,5-triol |
| SMILES | C[Si](C)(C)CC[C@]1(CO)NC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H25NO4Si/c1-17(2,3)5-4-11(7-13)10(16)9(15)8(14)6-12-11/h8-10,12-16H,4-7H2,1-3H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | OSJLYAXMCRVPHX-ZRUFSTJUSA-N |
| XLogP | -0.87 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|