C20H25N3O4S — CID 166525212
ethyl 3-[benzoylcarbamothioyl(2-propan-2-yloxyethyl)amino]-1H-pyrrole-2-carboxylate (PubChem CID 166525212) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is ethyl 3-[benzoylcarbamothioyl(2-propan-2-yloxyethyl)amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[benzoylcarbamothioyl(2-propan-2-yloxyethyl)amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166525212 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | ethyl 3-[benzoylcarbamothioyl(2-propan-2-yloxyethyl)amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1N(CCOC(C)C)C(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-4-26-19(25)17-16(10-11-21-17)23(12-13-27-14(2)3)20(28)22-18(24)15-8-6-5-7-9-15/h5-11,14,21H,4,12-13H2,1-3H3,(H,22,24,28) |
| InChIKey | WPTNPTJNTVBATM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|