C24H38F2N6O2 — CID 166527556
1,1-difluoropropane;4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]heptan-4-ol (PubChem CID 166527556) has the molecular formula C24H38F2N6O2 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1,1-difluoropropane;4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]heptan-4-ol.
| Compound Name | 1,1-difluoropropane;4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]heptan-4-ol |
|---|---|
| PubChem CID | 166527556 |
| Molecular Formula | C24H38F2N6O2 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 1,1-difluoropropane;4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]heptan-4-ol |
| SMILES | CCC(F)F.[H]/N=C/c1c(C(O)(CCC)CCC)cc(N2CCOCC2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C21H32N6O2.C3H6F2/c1-4-7-21(28,8-5-2)17-12-19(27-10-11-29-14-15(27)3)25-20(16(17)13-22)24-18-6-9-23-26-18;1-2-3(4)5/h6,9,12-13,15,22,28H,4-5,7-8,10-11,14H2,1-3H3,(H2,23,24,25,26);3H,2H2,1H3/b22-13+; |
| InChIKey | ZNUIPMXSEJFHEX-PNAHYYPNSA-N |
| XLogP | 5.22 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|