C18H25N7OS — CID 165400505
methanethiol;2-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]propanenitrile (PubChem CID 165400505) has the molecular formula C18H25N7OS and a molecular weight of 387.51 g/mol. Its IUPAC name is methanethiol;2-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]propanenitrile.
| Compound Name | methanethiol;2-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]propanenitrile |
|---|---|
| PubChem CID | 165400505 |
| Molecular Formula | C18H25N7OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | methanethiol;2-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]propanenitrile |
| SMILES | CS.[H]/N=C/c1c(C(C)C#N)cc(N2CCOCC2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C17H21N7O.CH4S/c1-11(8-18)13-7-16(24-5-6-25-10-12(24)2)22-17(14(13)9-19)21-15-3-4-20-23-15;1-2/h3-4,7,9,11-12,19H,5-6,10H2,1-2H3,(H2,20,21,22,23);2H,1H3/b19-9+; |
| InChIKey | CWBYRXOUZPAJIG-MYHMWQFYSA-N |
| XLogP | 2.94 |
| TPSA | 113.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|