C24H30N6O3 — CID 176647407
4-[4-hydroxy-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]cyclohexyl]but-3-yn-2-one (PubChem CID 176647407) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[4-hydroxy-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]cyclohexyl]but-3-yn-2-one.
| Compound Name | 4-[4-hydroxy-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]cyclohexyl]but-3-yn-2-one |
|---|---|
| PubChem CID | 176647407 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4-[4-hydroxy-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]cyclohexyl]but-3-yn-2-one |
| SMILES | [H]/N=C/c1c(C2(O)CCC(C#CC(C)=O)CC2)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C24H30N6O3/c1-16-15-33-12-11-30(16)22-13-20(19(14-25)23(28-22)27-21-7-10-26-29-21)24(32)8-5-18(6-9-24)4-3-17(2)31/h7,10,13-14,16,18,25,32H,5-6,8-9,11-12,15H2,1-2H3,(H2,26,27,28,29)/b25-14+/t16-,18?,24?/m1/s1 |
| InChIKey | OYBHTYPXGPJXAV-ZFRRTHLRSA-N |
| XLogP | 2.74 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|