C23H26N8O3 — CID 176647574
1-(2,6-diazaspiro[3.3]heptan-2-yl)-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]but-3-yne-1,2-dione (PubChem CID 176647574) has the molecular formula C23H26N8O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 1-(2,6-diazaspiro[3.3]heptan-2-yl)-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]but-3-yne-1,2-dione.
| Compound Name | 1-(2,6-diazaspiro[3.3]heptan-2-yl)-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]but-3-yne-1,2-dione |
|---|---|
| PubChem CID | 176647574 |
| Molecular Formula | C23H26N8O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-(2,6-diazaspiro[3.3]heptan-2-yl)-4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]but-3-yne-1,2-dione |
| SMILES | [H]/N=C/c1c(C#CC(=O)C(=O)N2CC3(CNC3)C2)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C23H26N8O3/c1-15-10-34-7-6-31(15)20-8-16(17(9-24)21(28-20)27-19-4-5-26-29-19)2-3-18(32)22(33)30-13-23(14-30)11-25-12-23/h4-5,8-9,15,24-25H,6-7,10-14H2,1H3,(H2,26,27,28,29)/b24-9+/t15-/m1/s1 |
| InChIKey | RKCTVOYEQGSAOV-ZKWOTWPISA-N |
| XLogP | 0.12 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|