C23H28N6O2S — CID 176647377
3-[2-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]ethynyl]-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 176647377) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-[2-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]ethynyl]-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[2-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]ethynyl]-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 176647377 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[2-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]ethynyl]-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | [H]/N=C/c1c(C#CC2(O)CC3CCC(C2)S3)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C23H28N6O2S/c1-15-14-31-9-8-29(15)21-10-16(4-6-23(30)11-17-2-3-18(12-23)32-17)19(13-24)22(27-21)26-20-5-7-25-28-20/h5,7,10,13,15,17-18,24,30H,2-3,8-9,11-12,14H2,1H3,(H2,25,26,27,28)/b24-13+/t15-,17?,18?,23?/m1/s1 |
| InChIKey | FKDUIUVBRWLFIC-YGCPWJHRSA-N |
| XLogP | 2.91 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|