C26H32N8O2 — CID 176647401
1-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]-4-[2-(1-methylpyrazol-3-yl)ethynyl]cyclohexan-1-ol (PubChem CID 176647401) has the molecular formula C26H32N8O2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 1-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]-4-[2-(1-methylpyrazol-3-yl)ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]-4-[2-(1-methylpyrazol-3-yl)ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176647401 |
| Molecular Formula | C26H32N8O2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 1-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]-4-[2-(1-methylpyrazol-3-yl)ethynyl]cyclohexan-1-ol |
| SMILES | [H]/N=C/c1c(C2(O)CCC(C#Cc3ccn(C)n3)CC2)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C26H32N8O2/c1-18-17-36-14-13-34(18)24-15-22(21(16-27)25(30-24)29-23-7-11-28-31-23)26(35)9-5-19(6-10-26)3-4-20-8-12-33(2)32-20/h7-8,11-12,15-16,18-19,27,35H,5-6,9-10,13-14,17H2,1-2H3,(H2,28,29,30,31)/b27-16+/t18-,19?,26?/m1/s1 |
| InChIKey | DWYQJCFZKWIYAH-SIHVEKCWSA-N |
| XLogP | 2.93 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|