C25H30ClN7O2 — CID 165400517
1-(4-chlorophenyl)-4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]piperidin-4-ol (PubChem CID 165400517) has the molecular formula C25H30ClN7O2 and a molecular weight of 496.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]piperidin-4-ol.
| Compound Name | 1-(4-chlorophenyl)-4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 165400517 |
| Molecular Formula | C25H30ClN7O2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[3-methanimidoyl-6-(3-methylmorpholin-4-yl)-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]piperidin-4-ol |
| SMILES | [H]/N=C/c1c(C2(O)CCN(c3ccc(Cl)cc3)CC2)cc(N2CCOCC2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C25H30ClN7O2/c1-17-16-35-13-12-33(17)23-14-21(20(15-27)24(30-23)29-22-6-9-28-31-22)25(34)7-10-32(11-8-25)19-4-2-18(26)3-5-19/h2-6,9,14-15,17,27,34H,7-8,10-13,16H2,1H3,(H2,28,29,30,31)/b27-15+ |
| InChIKey | QDPDEPVAAOHOLL-JFLMPSFJSA-N |
| XLogP | 3.91 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|