C19H25N7O — CID 176647369
4-[3-(dimethylamino)prop-1-ynyl]-3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-N-(1H-pyrazol-5-yl)pyridin-2-amine (PubChem CID 176647369) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-[3-(dimethylamino)prop-1-ynyl]-3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-N-(1H-pyrazol-5-yl)pyridin-2-amine.
| Compound Name | 4-[3-(dimethylamino)prop-1-ynyl]-3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-N-(1H-pyrazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 176647369 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 4-[3-(dimethylamino)prop-1-ynyl]-3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-N-(1H-pyrazol-5-yl)pyridin-2-amine |
| SMILES | [H]/N=C/c1c(C#CCN(C)C)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C19H25N7O/c1-14-13-27-10-9-26(14)18-11-15(5-4-8-25(2)3)16(12-20)19(23-18)22-17-6-7-21-24-17/h6-7,11-12,14,20H,8-10,13H2,1-3H3,(H2,21,22,23,24)/b20-12+/t14-/m1/s1 |
| InChIKey | UJKHXRCPZGTYKC-MQMKENTISA-N |
| XLogP | 1.68 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|