C17H16F3N — CID 166528334
(2Z,3E,5E)-5-phenyl-2-propylidene-3-(trifluoromethyl)hepta-3,5-dienenitrile (PubChem CID 166528334) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is (2Z,3E,5E)-5-phenyl-2-propylidene-3-(trifluoromethyl)hepta-3,5-dienenitrile.
| Compound Name | (2Z,3E,5E)-5-phenyl-2-propylidene-3-(trifluoromethyl)hepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 166528334 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2Z,3E,5E)-5-phenyl-2-propylidene-3-(trifluoromethyl)hepta-3,5-dienenitrile |
| SMILES | C/C=C(\C=C(C(/C#N)=C/CC)\C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H16F3N/c1-3-8-15(12-21)16(17(18,19)20)11-13(4-2)14-9-6-5-7-10-14/h4-11H,3H2,1-2H3/b13-4+,15-8+,16-11+ |
| InChIKey | XFJLJSQZNJOMAJ-NIABIYRCSA-N |
| XLogP | 5.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|