C48H30 — CID 166544891
12-[1,2,3,4,5,6,7,10-octadeuterio-8-(2-phenylphenyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene (PubChem CID 166544891) has the molecular formula C48H30 and a molecular weight of 614.82 g/mol. Its IUPAC name is 12-[1,2,3,4,5,6,7,10-octadeuterio-8-(2-phenylphenyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene.
| Compound Name | 12-[1,2,3,4,5,6,7,10-octadeuterio-8-(2-phenylphenyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 166544891 |
| Molecular Formula | C48H30 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 12-[1,2,3,4,5,6,7,10-octadeuterio-8-(2-phenylphenyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4c5ccccc5c5ccc6ccccc6c5c34)c3c(-c4ccccc4-c4ccccc4)c([2H])c([2H])c([2H])c3c([2H])c2c1[2H] |
| InChI | InChI=1S/C48H30/c1-2-14-31(15-3-1)35-19-8-9-22-38(35)41-25-12-18-34-30-33-17-5-7-21-37(33)47(45(34)41)44-27-13-26-42-39-23-10-11-24-40(39)43-29-28-32-16-4-6-20-36(32)46(43)48(42)44/h1-30H/i5D,7D,12D,17D,18D,21D,25D,30D |
| InChIKey | YPZOPVMVKRVBNK-MHHCYJNWSA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|