C36H37B2NO3P2 — CID 16655301
CID 16655301 (PubChem CID 16655301) has the molecular formula C36H37B2NO3P2 and a molecular weight of 615.27 g/mol.
| Compound Name | CID 16655301 |
|---|---|
| PubChem CID | 16655301 |
| Molecular Formula | C36H37B2NO3P2 |
| Molecular Weight | 615.27 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | — |
| SMILES | COc1ccccc1[P@@](O[C@@H](c1ccccc1)[C@@H](C)N(C)[P@@](c1ccccc1)c1ccccc1OC)c1ccccc1.[B].[B] |
| InChI | InChI=1S/C36H37NO3P2.2B/c1-28(37(2)41(30-20-10-6-11-21-30)34-26-16-14-24-32(34)38-3)36(29-18-8-5-9-19-29)40-42(31-22-12-7-13-23-31)35-27-17-15-25-33(35)39-4;;/h5-28,36H,1-4H3;;/t28-,36-,41+,42+;;/m1../s1 |
| InChIKey | JBAFOHFHGVRNFZ-QQYDSMCTSA-N |
| XLogP | 6.42 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.27 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|