C13H16N2O — CID 166554301
1-(1,3-oxazol-2-yl)-4-phenylbutan-1-amine (PubChem CID 166554301) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1,3-oxazol-2-yl)-4-phenylbutan-1-amine.
| Compound Name | 1-(1,3-oxazol-2-yl)-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 166554301 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(1,3-oxazol-2-yl)-4-phenylbutan-1-amine |
| SMILES | NC(CCCc1ccccc1)c1ncco1 |
| InChI | InChI=1S/C13H16N2O/c14-12(13-15-9-10-16-13)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,12H,4,7-8,14H2 |
| InChIKey | ISVKHLNDJJDBGR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |