C14H19NO2 — CID 16655666
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 16655666) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 16655666 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/[C@H]1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-11(12-7-5-4-6-8-12)15-9-13-10-16-14(2,3)17-13/h4-9,11,13H,10H2,1-3H3/b15-9+/t11-,13-/m0/s1 |
| InChIKey | LJQNEWWYKAKRTF-KQAANWFRSA-N |
| XLogP | 2.97 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|