C21H26BN3O2 — CID 166556730
4-methyl-3-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,4-triazole (PubChem CID 166556730) has the molecular formula C21H26BN3O2 and a molecular weight of 363.27 g/mol. Its IUPAC name is 4-methyl-3-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,4-triazole.
| Compound Name | 4-methyl-3-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 166556730 |
| Molecular Formula | C21H26BN3O2 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 4-methyl-3-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,4-triazole |
| SMILES | Cn1cnnc1C1=CCCC=C1c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H26BN3O2/c1-20(2)21(3,4)27-22(26-20)16-10-8-9-15(13-16)17-11-6-7-12-18(17)19-24-23-14-25(19)5/h8-14H,6-7H2,1-5H3 |
| InChIKey | SYXBPQQYEICLKA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|