C30H24N2O3 — CID 16655892
(E)-1-[(2R,3R)-1-benzhydryl-3-(4-nitrophenyl)aziridin-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 16655892) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is (E)-1-[(2R,3R)-1-benzhydryl-3-(4-nitrophenyl)aziridin-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2R,3R)-1-benzhydryl-3-(4-nitrophenyl)aziridin-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 16655892 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (E)-1-[(2R,3R)-1-benzhydryl-3-(4-nitrophenyl)aziridin-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)[C@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O3/c33-27(21-16-22-10-4-1-5-11-22)30-29(25-17-19-26(20-18-25)32(34)35)31(30)28(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-21,28-30H/b21-16+/t29-,30+,31?/m1/s1 |
| InChIKey | HLCRJADDZBWMOJ-QDKNQPHVSA-N |
| XLogP | 6.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|