C16H14N3S+ — CID 166570668
4-methyl-3-(2-methylphenyl)-7-thia-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 166570668) has the molecular formula C16H14N3S+ and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-methyl-3-(2-methylphenyl)-7-thia-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 4-methyl-3-(2-methylphenyl)-7-thia-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 166570668 |
| Molecular Formula | C16H14N3S+ |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-methyl-3-(2-methylphenyl)-7-thia-2,9-diaza-4-azoniatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | Cc1ccccc1-c1n2c(c[n+]1C)sc1ncccc12 |
| InChI | InChI=1S/C16H14N3S/c1-11-6-3-4-7-12(11)16-18(2)10-14-19(16)13-8-5-9-17-15(13)20-14/h3-10H,1-2H3/q+1 |
| InChIKey | ZENKQEHQUWNYOU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|