C22H23ClN4 — CID 87777720
2,3,5-tris(2-methylphenyl)-1H-tetrazol-1-ium chloride (PubChem CID 87777720) has the molecular formula C22H23ClN4 and a molecular weight of 378.91 g/mol. Its IUPAC name is 2,3,5-tris(2-methylphenyl)-1H-tetrazol-1-ium chloride.
| Compound Name | 2,3,5-tris(2-methylphenyl)-1H-tetrazol-1-ium chloride |
|---|---|
| PubChem CID | 87777720 |
| Molecular Formula | C22H23ClN4 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2,3,5-tris(2-methylphenyl)-1H-tetrazol-1-ium chloride |
| SMILES | Cc1ccccc1C1=NN(c2ccccc2C)N(c2ccccc2C)[NH2+]1.[Cl-] |
| InChI | InChI=1S/C22H22N4.ClH/c1-16-10-4-7-13-19(16)22-23-25(20-14-8-5-11-17(20)2)26(24-22)21-15-9-6-12-18(21)3;/h4-15H,1-3H3,(H,23,24);1H |
| InChIKey | NXIIHQOBLPLSIS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|