About 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride
3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride (PubChem CID 57374562) has the molecular formula C21H21ClN4
and a molecular weight of 364.88 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride.
Molecular Properties
| Compound Name | 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride |
| PubChem CID | 57374562 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride |
| SMILES | Cc1cccc(C)c1N1N=C(c2ccccc2)[NH2+]N1c1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H20N4.ClH/c1-16-10-9-11-17(2)20(16)25-23-21(18-12-5-3-6-13-18)22-24(25)19-14-7-4-8-15-19;/h3-15H,1-2H3,(H,22,23);1H |
| InChIKey | RFNMDSAWEXNWFU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride?
The IUPAC name of 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride (CID 57374562) is 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride.
What is the SMILES notation for 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride?
The canonical SMILES for 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride is Cc1cccc(C)c1N1N=C(c2ccccc2)[NH2+]N1c1ccccc1.[Cl-].
What is the InChIKey of 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride?
The InChIKey is RFNMDSAWEXNWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4.ClH/c1-16-10-9-11-17(2)20(16)25-23-21(18-12-5-3-6-13-18)22-24(25)19-14-7-4-8-15-19;/h3-15H,1-2H3,(H,22,23);1H.
What are the key properties of 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride?
3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride has a molecular weight of 364.88 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenyl)-2,5-diphenyl-1H-tetrazol-1-ium chloride is sourced from PubChem (CID 57374562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).