C25H21ClN4 — CID 86002969
2,5-diphenyl-3-(4-phenylphenyl)-1H-tetrazol-1-ium chloride (PubChem CID 86002969) has the molecular formula C25H21ClN4 and a molecular weight of 412.92 g/mol. Its IUPAC name is 2,5-diphenyl-3-(4-phenylphenyl)-1H-tetrazol-1-ium chloride.
| Compound Name | 2,5-diphenyl-3-(4-phenylphenyl)-1H-tetrazol-1-ium chloride |
|---|---|
| PubChem CID | 86002969 |
| Molecular Formula | C25H21ClN4 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2,5-diphenyl-3-(4-phenylphenyl)-1H-tetrazol-1-ium chloride |
| SMILES | [Cl-].c1ccc(C2=NN(c3ccc(-c4ccccc4)cc3)N(c3ccccc3)[NH2+]2)cc1 |
| InChI | InChI=1S/C25H20N4.ClH/c1-4-10-20(11-5-1)21-16-18-24(19-17-21)29-27-25(22-12-6-2-7-13-22)26-28(29)23-14-8-3-9-15-23;/h1-19H,(H,26,27);1H |
| InChIKey | BJPKWXVZOANREC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|