C31H30F2N8O4 — CID 166579790
[3-(5-aminopentylcarbamoyl)-6-[[3-(2,3-difluoro-4-pyrimidin-2-yloxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl] formate (PubChem CID 166579790) has the molecular formula C31H30F2N8O4 and a molecular weight of 616.63 g/mol. Its IUPAC name is [3-(5-aminopentylcarbamoyl)-6-[[3-(2,3-difluoro-4-pyrimidin-2-yloxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl] formate.
| Compound Name | [3-(5-aminopentylcarbamoyl)-6-[[3-(2,3-difluoro-4-pyrimidin-2-yloxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl] formate |
|---|---|
| PubChem CID | 166579790 |
| Molecular Formula | C31H30F2N8O4 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | [3-(5-aminopentylcarbamoyl)-6-[[3-(2,3-difluoro-4-pyrimidin-2-yloxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl] formate |
| SMILES | CCc1c(C(=O)NCCCCCN)ccc(Nc2nccn3c(-c4ccc(Oc5ncccn5)c(F)c4F)cnc23)c1OC=O |
| InChI | InChI=1S/C31H30F2N8O4/c1-2-19-20(30(43)36-12-5-3-4-11-34)7-9-22(27(19)44-18-42)40-28-29-39-17-23(41(29)16-15-35-28)21-8-10-24(26(33)25(21)32)45-31-37-13-6-14-38-31/h6-10,13-18H,2-5,11-12,34H2,1H3,(H,35,40)(H,36,43) |
| InChIKey | DQCXJZHZNZENIO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 158.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|