C13H19BClN3O2 — CID 166590513
N-[3-[(2-chloro-5-formyl-4-pyridinyl)amino]cyclohexyl]-methylboronamidic acid (PubChem CID 166590513) has the molecular formula C13H19BClN3O2 and a molecular weight of 295.58 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-formyl-4-pyridinyl)amino]cyclohexyl]-methylboronamidic acid.
| Compound Name | N-[3-[(2-chloro-5-formyl-4-pyridinyl)amino]cyclohexyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 166590513 |
| Molecular Formula | C13H19BClN3O2 |
| Molecular Weight | 295.58 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[3-[(2-chloro-5-formyl-4-pyridinyl)amino]cyclohexyl]-methylboronamidic acid |
| SMILES | CB(O)NC1CCCC(Nc2cc(Cl)ncc2C=O)C1 |
| InChI | InChI=1S/C13H19BClN3O2/c1-14(20)18-11-4-2-3-10(5-11)17-12-6-13(15)16-7-9(12)8-19/h6-8,10-11,18,20H,2-5H2,1H3,(H,16,17) |
| InChIKey | GEDDWGGSMAHJBW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|