C32H29BrN2O10S3 — CID 166593568
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[4-amino-3-(1,3-benzothiazol-2-yl)-5-(4-bromobenzoyl)thiophen-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 166593568) has the molecular formula C32H29BrN2O10S3 and a molecular weight of 777.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[4-amino-3-(1,3-benzothiazol-2-yl)-5-(4-bromobenzoyl)thiophen-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[4-amino-3-(1,3-benzothiazol-2-yl)-5-(4-bromobenzoyl)thiophen-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166593568 |
| Molecular Formula | C32H29BrN2O10S3 |
| Molecular Weight | 777.69 g/mol |
| Exact Mass | 776.02 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[4-amino-3-(1,3-benzothiazol-2-yl)-5-(4-bromobenzoyl)thiophen-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Sc2sc(C(=O)c3ccc(Br)cc3)c(N)c2-c2nc3ccccc3s2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H29BrN2O10S3/c1-14(36)41-13-21-26(42-15(2)37)27(43-16(3)38)28(44-17(4)39)31(45-21)48-32-23(30-35-20-7-5-6-8-22(20)46-30)24(34)29(47-32)25(40)18-9-11-19(33)12-10-18/h5-12,21,26-28,31H,13,34H2,1-4H3/t21-,26+,27+,28-,31?/m1/s1 |
| InChIKey | CYIHWQMUPAKXIU-GAMTVQFFSA-N |
| XLogP | 5.78 |
| TPSA | 170.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|