C22H31BN4O4 — CID 166595317
N-(2-methoxyphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxamide (PubChem CID 166595317) has the molecular formula C22H31BN4O4 and a molecular weight of 426.33 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166595317 |
| Molecular Formula | C22H31BN4O4 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C22H31BN4O4/c1-21(2)22(3,4)31-23(30-21)16-14-24-27(15-16)17-10-12-26(13-11-17)20(28)25-18-8-6-7-9-19(18)29-5/h6-9,14-15,17H,10-13H2,1-5H3,(H,25,28) |
| InChIKey | UKSSHHOPIVJUDS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|