C10H9ClF3N3O2 — CID 166597115
ethyl 2-[(2E)-2-(1-chloro-2,2,2-trifluoroethylidene)hydrazinyl]pyridine-3-carboxylate (PubChem CID 166597115) has the molecular formula C10H9ClF3N3O2 and a molecular weight of 295.65 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-(1-chloro-2,2,2-trifluoroethylidene)hydrazinyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(2E)-2-(1-chloro-2,2,2-trifluoroethylidene)hydrazinyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 166597115 |
| Molecular Formula | C10H9ClF3N3O2 |
| Molecular Weight | 295.65 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | ethyl 2-[(2E)-2-(1-chloro-2,2,2-trifluoroethylidene)hydrazinyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1N/N=C(/Cl)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3N3O2/c1-2-19-8(18)6-4-3-5-15-7(6)16-17-9(11)10(12,13)14/h3-5H,2H2,1H3,(H,15,16)/b17-9+ |
| InChIKey | NYQUFVZUOLCCJV-RQZCQDPDSA-N |
| XLogP | 2.78 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|